C8H8BNO2 — CID 174053071
3,3a-dihydro-2,1-benzoxaborole-3-carboxamide (PubChem CID 174053071) has the molecular formula C8H8BNO2 and a molecular weight of 160.97 g/mol. Its IUPAC name is 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide.
| Compound Name | 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide |
|---|---|
| PubChem CID | 174053071 |
| Molecular Formula | C8H8BNO2 |
| Molecular Weight | 160.97 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide |
| SMILES | NC(=O)C1OB=C2C=CC=CC21 |
| InChI | InChI=1S/C8H8BNO2/c10-8(11)7-5-3-1-2-4-6(5)9-12-7/h1-5,7H,(H2,10,11) |
| InChIKey | RSZWPBTVNLVFOX-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.97 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|