About 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide
3,3a-dihydro-2,1-benzoxaborole-3-carboxamide (PubChem CID 174053071) has the molecular formula C8H8BNO2
and a molecular weight of 160.97 g/mol. Its IUPAC name is 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide.
Molecular Properties
| Compound Name | 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide |
| PubChem CID | 174053071 |
| Molecular Formula | C8H8BNO2 |
| Molecular Weight | 160.97 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide |
| SMILES | NC(=O)C1OB=C2C=CC=CC21 |
| InChI | InChI=1S/C8H8BNO2/c10-8(11)7-5-3-1-2-4-6(5)9-12-7/h1-5,7H,(H2,10,11) |
| InChIKey | RSZWPBTVNLVFOX-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.97 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide?
The IUPAC name of 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide (CID 174053071) is 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide.
What is the SMILES notation for 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide?
The canonical SMILES for 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide is NC(=O)C1OB=C2C=CC=CC21.
What is the InChIKey of 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide?
The InChIKey is RSZWPBTVNLVFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BNO2/c10-8(11)7-5-3-1-2-4-6(5)9-12-7/h1-5,7H,(H2,10,11).
What are the key properties of 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide?
3,3a-dihydro-2,1-benzoxaborole-3-carboxamide has a molecular weight of 160.97 g/mol, XLogP of -0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3a-dihydro-2,1-benzoxaborole-3-carboxamide is sourced from PubChem (CID 174053071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).