C16H24BN2Na — CID 174054628
CID 174054628 (PubChem CID 174054628) has the molecular formula C16H24BN2Na and a molecular weight of 278.18 g/mol.
| Compound Name | CID 174054628 |
|---|---|
| PubChem CID | 174054628 |
| Molecular Formula | C16H24BN2Na |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | — |
| SMILES | CC1CCC(c2ccc3c(c2)CN(C)CC3)NC1.[B-].[Na+] |
| InChI | InChI=1S/C16H24N2.B.Na/c1-12-3-6-16(17-10-12)14-5-4-13-7-8-18(2)11-15(13)9-14;;/h4-5,9,12,16-17H,3,6-8,10-11H2,1-2H3;;/q;-1;+1 |
| InChIKey | BIDLAXMDOGHKPL-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|