C36H38N4O2 — CID 174055714
[2-[4-[(1-butyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)methyl]-3-oxocyclobuten-1-yl]-2-cyanoethenylidene]azanide (PubChem CID 174055714) has the molecular formula C36H38N4O2 and a molecular weight of 558.73 g/mol. Its IUPAC name is [2-[4-[(1-butyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)methyl]-3-oxocyclobuten-1-yl]-2-cyanoethenylidene]azanide.
| Compound Name | [2-[4-[(1-butyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)methyl]-3-oxocyclobuten-1-yl]-2-cyanoethenylidene]azanide |
|---|---|
| PubChem CID | 174055714 |
| Molecular Formula | C36H38N4O2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | [2-[4-[(1-butyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[(1-ethyl-5-methoxy-3,3-dimethylindol-2-ylidene)methyl]-3-oxocyclobuten-1-yl]-2-cyanoethenylidene]azanide |
| SMILES | CCCC[N+]1=C(C=C2C(=O)C(C=C3N(CC)c4ccc(OC)cc4C3(C)C)=C2C(=C=[N-])C#N)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C36H38N4O2/c1-8-10-17-40-29-14-12-11-13-27(29)35(3,4)32(40)20-26-33(23(21-37)22-38)25(34(26)41)19-31-36(5,6)28-18-24(42-7)15-16-30(28)39(31)9-2/h11-16,18-20H,8-10,17H2,1-7H3 |
| InChIKey | KNRUYELUUSPEQW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 78.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|