C36H37N3O4 — CID 177499713
(4E)-4-[[1-butyl-5-[(Z)-2-carboxy-2-cyanoethenyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]-3-oxocyclobuten-1-olate (PubChem CID 177499713) has the molecular formula C36H37N3O4 and a molecular weight of 575.71 g/mol. Its IUPAC name is (4E)-4-[[1-butyl-5-[(Z)-2-carboxy-2-cyanoethenyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]-3-oxocyclobuten-1-olate.
| Compound Name | (4E)-4-[[1-butyl-5-[(Z)-2-carboxy-2-cyanoethenyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 177499713 |
| Molecular Formula | C36H37N3O4 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | (4E)-4-[[1-butyl-5-[(Z)-2-carboxy-2-cyanoethenyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]-3-oxocyclobuten-1-olate |
| SMILES | CCCC[N+]1=C(/C=C2/C(=O)C(/C=C3/N(CC)c4ccccc4C3(C)C)=C2[O-])C(C)(C)c2cc(/C=C(/C#N)C(=O)O)ccc21 |
| InChI | InChI=1S/C36H37N3O4/c1-7-9-16-39-29-15-14-22(17-23(21-37)34(42)43)18-27(29)36(5,6)31(39)20-25-32(40)24(33(25)41)19-30-35(3,4)26-12-10-11-13-28(26)38(30)8-2/h10-15,17-20H,7-9,16H2,1-6H3,(H-,40,41,42,43)/b23-17- |
| InChIKey | ZULAFKRUMNFNFV-QJOMJCCJSA-N |
| XLogP | 5.68 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|