About gold(1+);triethoxy(propyl)silane
gold(1+);triethoxy(propyl)silane (PubChem CID 174059879) has the molecular formula C9H21AuO3Si
and a molecular weight of 402.32 g/mol. Its IUPAC name is gold(1+);triethoxy(propyl)silane.
Molecular Properties
| Compound Name | gold(1+);triethoxy(propyl)silane |
| PubChem CID | 174059879 |
| Molecular Formula | C9H21AuO3Si |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | gold(1+);triethoxy(propyl)silane |
| SMILES | [Au+].[CH2-]CC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C9H21O3Si.Au/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h1,5-9H2,2-4H3;/q-1;+1 |
| InChIKey | VEUVLYZAFZZJMU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);triethoxy(propyl)silane?
The IUPAC name of gold(1+);triethoxy(propyl)silane (CID 174059879) is gold(1+);triethoxy(propyl)silane.
What is the SMILES notation for gold(1+);triethoxy(propyl)silane?
The canonical SMILES for gold(1+);triethoxy(propyl)silane is [Au+].[CH2-]CC[Si](OCC)(OCC)OCC.
What is the InChIKey of gold(1+);triethoxy(propyl)silane?
The InChIKey is VEUVLYZAFZZJMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21O3Si.Au/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h1,5-9H2,2-4H3;/q-1;+1.
What are the key properties of gold(1+);triethoxy(propyl)silane?
gold(1+);triethoxy(propyl)silane has a molecular weight of 402.32 g/mol, XLogP of 2.26, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);triethoxy(propyl)silane is sourced from PubChem (CID 174059879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).