C21H30Si2 — CID 174063325
2-tert-butyl-5,5,7,10,10-pentamethylsilanthrene (PubChem CID 174063325) has the molecular formula C21H30Si2 and a molecular weight of 338.64 g/mol. Its IUPAC name is 2-tert-butyl-5,5,7,10,10-pentamethylsilanthrene.
| Compound Name | 2-tert-butyl-5,5,7,10,10-pentamethylsilanthrene |
|---|---|
| PubChem CID | 174063325 |
| Molecular Formula | C21H30Si2 |
| Molecular Weight | 338.64 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-tert-butyl-5,5,7,10,10-pentamethylsilanthrene |
| SMILES | Cc1ccc2c(c1)[Si](C)(C)c1ccc(C(C)(C)C)cc1[Si]2(C)C |
| InChI | InChI=1S/C21H30Si2/c1-15-9-11-17-19(13-15)22(5,6)18-12-10-16(21(2,3)4)14-20(18)23(17,7)8/h9-14H,1-8H3 |
| InChIKey | KPQWSQNFHCMNBV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|