C36H51NSi3 — CID 158710594
5,11,17-tritert-butyl-8,8,14,14,22,22-hexamethyl-1-aza-8,14,22-trisilahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 158710594) has the molecular formula C36H51NSi3 and a molecular weight of 582.07 g/mol. Its IUPAC name is 5,11,17-tritert-butyl-8,8,14,14,22,22-hexamethyl-1-aza-8,14,22-trisilahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 5,11,17-tritert-butyl-8,8,14,14,22,22-hexamethyl-1-aza-8,14,22-trisilahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 158710594 |
| Molecular Formula | C36H51NSi3 |
| Molecular Weight | 582.07 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | 5,11,17-tritert-butyl-8,8,14,14,22,22-hexamethyl-1-aza-8,14,22-trisilahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)[Si](C)(C)c1cc(C(C)(C)C)cc4c1N3c1c(cc(C(C)(C)C)cc1[Si]4(C)C)[Si]2(C)C |
| InChI | InChI=1S/C36H51NSi3/c1-34(2,3)22-16-25-31-26(17-22)39(12,13)28-19-24(36(7,8)9)21-30-33(28)37(31)32-27(38(25,10)11)18-23(35(4,5)6)20-29(32)40(30,14)15/h16-21H,1-15H3 |
| InChIKey | IIQYFXQACQSNBR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.07 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|