C39H42BN3Si — CID 168759715
2,7-ditert-butyl-10-(5,5-dimethylbenzo[b][1,4]benzosilaborinin-10-yl)-9,9-dimethylacridine-4,5-dicarbonitrile (PubChem CID 168759715) has the molecular formula C39H42BN3Si and a molecular weight of 591.68 g/mol. Its IUPAC name is 2,7-ditert-butyl-10-(5,5-dimethylbenzo[b][1,4]benzosilaborinin-10-yl)-9,9-dimethylacridine-4,5-dicarbonitrile.
| Compound Name | 2,7-ditert-butyl-10-(5,5-dimethylbenzo[b][1,4]benzosilaborinin-10-yl)-9,9-dimethylacridine-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 168759715 |
| Molecular Formula | C39H42BN3Si |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.32 |
| IUPAC Name | 2,7-ditert-butyl-10-(5,5-dimethylbenzo[b][1,4]benzosilaborinin-10-yl)-9,9-dimethylacridine-4,5-dicarbonitrile |
| SMILES | CC(C)(C)c1cc(C#N)c2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(C#N)c1N2B1c2ccccc2[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C39H42BN3Si/c1-37(2,3)27-19-25(23-41)35-29(21-27)39(7,8)30-22-28(38(4,5)6)20-26(24-42)36(30)43(35)40-31-15-11-13-17-33(31)44(9,10)34-18-14-12-16-32(34)40/h11-22H,1-10H3 |
| InChIKey | SHTFONYOFLXQLG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|