C45H42BN3 — CID 168759552
2,7-ditert-butyl-9,9-dimethyl-10-(1-methyl-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaen-13-yl)acridine-4,5-dicarbonitrile (PubChem CID 168759552) has the molecular formula C45H42BN3 and a molecular weight of 635.66 g/mol. Its IUPAC name is 2,7-ditert-butyl-9,9-dimethyl-10-(1-methyl-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaen-13-yl)acridine-4,5-dicarbonitrile.
| Compound Name | 2,7-ditert-butyl-9,9-dimethyl-10-(1-methyl-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaen-13-yl)acridine-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 168759552 |
| Molecular Formula | C45H42BN3 |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 635.35 |
| IUPAC Name | 2,7-ditert-butyl-9,9-dimethyl-10-(1-methyl-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8,10,12(20),14,16,18-nonaen-13-yl)acridine-4,5-dicarbonitrile |
| SMILES | CC(C)(C)c1cc(C#N)c2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(C#N)c1N2B1c2ccccc2C2(C)c3ccccc3-c3cccc1c32 |
| InChI | InChI=1S/C45H42BN3/c1-42(2,3)29-21-27(25-47)40-35(23-29)44(7,8)36-24-30(43(4,5)6)22-28(26-48)41(36)49(40)46-37-19-13-12-18-34(37)45(9)33-17-11-10-15-31(33)32-16-14-20-38(46)39(32)45/h10-24H,1-9H3 |
| InChIKey | CNOTULKCTBCTSZ-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|