C16H25NO2 — CID 174064917
6-(4,4-dimethylcyclohexyl)-3-ethyl-4-hydroxy-6-oxohex-4-enenitrile (PubChem CID 174064917) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 6-(4,4-dimethylcyclohexyl)-3-ethyl-4-hydroxy-6-oxohex-4-enenitrile.
| Compound Name | 6-(4,4-dimethylcyclohexyl)-3-ethyl-4-hydroxy-6-oxohex-4-enenitrile |
|---|---|
| PubChem CID | 174064917 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 6-(4,4-dimethylcyclohexyl)-3-ethyl-4-hydroxy-6-oxohex-4-enenitrile |
| SMILES | CCC(CC#N)C(O)=CC(=O)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H25NO2/c1-4-12(7-10-17)14(18)11-15(19)13-5-8-16(2,3)9-6-13/h11-13,18H,4-9H2,1-3H3 |
| InChIKey | DJBPWHTVQOOPGY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|