C20H34O2 — CID 138517729
(Z)-1-(2,2-dimethylspiro[3.5]nonan-7-yl)-4-ethyl-3-methoxyhex-2-en-1-one (PubChem CID 138517729) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (Z)-1-(2,2-dimethylspiro[3.5]nonan-7-yl)-4-ethyl-3-methoxyhex-2-en-1-one.
| Compound Name | (Z)-1-(2,2-dimethylspiro[3.5]nonan-7-yl)-4-ethyl-3-methoxyhex-2-en-1-one |
|---|---|
| PubChem CID | 138517729 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (Z)-1-(2,2-dimethylspiro[3.5]nonan-7-yl)-4-ethyl-3-methoxyhex-2-en-1-one |
| SMILES | CCC(CC)/C(=C/C(=O)C1CCC2(CC1)CC(C)(C)C2)OC |
| InChI | InChI=1S/C20H34O2/c1-6-15(7-2)18(22-5)12-17(21)16-8-10-20(11-9-16)13-19(3,4)14-20/h12,15-16H,6-11,13-14H2,1-5H3/b18-12- |
| InChIKey | VVMPRHYXJLAMIZ-PDGQHHTCSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|