C10H16N2 — CID 174068168
N-methyl-1-(4-methyl-2H-pyrrol-5-yl)but-1-en-2-amine (PubChem CID 174068168) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-2H-pyrrol-5-yl)but-1-en-2-amine.
| Compound Name | N-methyl-1-(4-methyl-2H-pyrrol-5-yl)but-1-en-2-amine |
|---|---|
| PubChem CID | 174068168 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-methyl-1-(4-methyl-2H-pyrrol-5-yl)but-1-en-2-amine |
| SMILES | CCC(=CC1=NCC=C1C)NC |
| InChI | InChI=1S/C10H16N2/c1-4-9(11-3)7-10-8(2)5-6-12-10/h5,7,11H,4,6H2,1-3H3 |
| InChIKey | OAIPUKKQKOSAIH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |