C16H22FN3O4 — CID 174074844
tert-butyl (3S)-6-fluoro-8-(N'-hydroxycarbamimidoyl)-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (PubChem CID 174074844) has the molecular formula C16H22FN3O4 and a molecular weight of 339.37 g/mol. Its IUPAC name is tert-butyl (3S)-6-fluoro-8-(N'-hydroxycarbamimidoyl)-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate.
| Compound Name | tert-butyl (3S)-6-fluoro-8-(N'-hydroxycarbamimidoyl)-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
|---|---|
| PubChem CID | 174074844 |
| Molecular Formula | C16H22FN3O4 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | tert-butyl (3S)-6-fluoro-8-(N'-hydroxycarbamimidoyl)-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| SMILES | C[C@H]1COc2cc(C(N)=NO)cc(F)c2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22FN3O4/c1-9-8-23-13-6-10(14(18)19-22)5-12(17)11(13)7-20(9)15(21)24-16(2,3)4/h5-6,9,22H,7-8H2,1-4H3,(H2,18,19)/t9-/m0/s1 |
| InChIKey | ZREKFYFZGLHSHU-VIFPVBQESA-N |
| XLogP | 2.44 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|