C19H18F3N5 — CID 174085156
1,1,1-trifluoro-4-imino-3-(9-methyl-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)but-2-en-2-amine (PubChem CID 174085156) has the molecular formula C19H18F3N5 and a molecular weight of 373.38 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-imino-3-(9-methyl-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)but-2-en-2-amine.
| Compound Name | 1,1,1-trifluoro-4-imino-3-(9-methyl-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)but-2-en-2-amine |
|---|---|
| PubChem CID | 174085156 |
| Molecular Formula | C19H18F3N5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1,1,1-trifluoro-4-imino-3-(9-methyl-8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)but-2-en-2-amine |
| SMILES | [H]/N=C/C(=C(N)C(F)(F)F)c1nc2ccc3[nH]ncc3c2c2c1CC(C)CC2 |
| InChI | InChI=1S/C19H18F3N5/c1-9-2-3-10-11(6-9)17(12(7-23)18(24)19(20,21)22)26-15-5-4-14-13(16(10)15)8-25-27-14/h4-5,7-9,23H,2-3,6,24H2,1H3,(H,25,27)/b18-12?,23-7+ |
| InChIKey | AMQBSQHTYXQPPM-PMHPTDQISA-N |
| XLogP | 4.12 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|