C16H12F3N5O — CID 174115700
1,1,1-trifluoro-4-imino-3-(3-oxa-8,13,14-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2(6),7,10,12(16),14-hexaen-7-yl)but-2-en-2-amine (PubChem CID 174115700) has the molecular formula C16H12F3N5O and a molecular weight of 347.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-imino-3-(3-oxa-8,13,14-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2(6),7,10,12(16),14-hexaen-7-yl)but-2-en-2-amine.
| Compound Name | 1,1,1-trifluoro-4-imino-3-(3-oxa-8,13,14-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2(6),7,10,12(16),14-hexaen-7-yl)but-2-en-2-amine |
|---|---|
| PubChem CID | 174115700 |
| Molecular Formula | C16H12F3N5O |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1,1,1-trifluoro-4-imino-3-(3-oxa-8,13,14-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2(6),7,10,12(16),14-hexaen-7-yl)but-2-en-2-amine |
| SMILES | [H]/N=C/C(=C(N)C(F)(F)F)c1nc2ccc3[nH]ncc3c2c2c1CCO2 |
| InChI | InChI=1S/C16H12F3N5O/c17-16(18,19)15(21)8(5-20)13-7-3-4-25-14(7)12-9-6-22-24-10(9)1-2-11(12)23-13/h1-2,5-6,20H,3-4,21H2,(H,22,24)/b15-8?,20-5+ |
| InChIKey | JBQLRYWUNJOQFC-JYVFFIAKSA-N |
| XLogP | 2.93 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|