C16H16N6 — CID 174085163
2-hydrazinylidene-2-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)ethanimine (PubChem CID 174085163) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 2-hydrazinylidene-2-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)ethanimine.
| Compound Name | 2-hydrazinylidene-2-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)ethanimine |
|---|---|
| PubChem CID | 174085163 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-hydrazinylidene-2-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)ethanimine |
| SMILES | [H]/N=C/C(=NN)c1nc2ccc3[nH]ncc3c2c2c1CCCC2 |
| InChI | InChI=1S/C16H16N6/c17-7-14(21-18)16-10-4-2-1-3-9(10)15-11-8-19-22-12(11)5-6-13(15)20-16/h5-8,17H,1-4,18H2,(H,19,22)/b17-7+,21-14? |
| InChIKey | MWGYVUUJEBRJQU-CBIZNEJFSA-N |
| XLogP | 2.30 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|