C17H19B3N6O5 — CID 174087141
CID 174087141 (PubChem CID 174087141) has the molecular formula C17H19B3N6O5 and a molecular weight of 419.81 g/mol.
| Compound Name | CID 174087141 |
|---|---|
| PubChem CID | 174087141 |
| Molecular Formula | C17H19B3N6O5 |
| Molecular Weight | 419.81 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | — |
| SMILES | [B]c1cc([C@]2(C#N)OC(C([B])([B])O)[C@@H](OC(=O)[C@@H](N)C(C)C)[C@H]2O)n2ncnc(N)c12 |
| InChI | InChI=1S/C17H19B3N6O5/c1-6(2)9(22)15(28)30-11-12(27)16(4-21,31-13(11)17(19,20)29)8-3-7(18)10-14(23)24-5-25-26(8)10/h3,5-6,9,11-13,27,29H,22H2,1-2H3,(H2,23,24,25)/t9-,11-,12+,13?,16-/m0/s1 |
| InChIKey | JLFVIHNUYCBQPY-OLCQNURNSA-N |
| XLogP | -3.54 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.81 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|