C16H18BN5O5 — CID 174087116
CID 174087116 (PubChem CID 174087116) has the molecular formula C16H18BN5O5 and a molecular weight of 371.16 g/mol.
| Compound Name | CID 174087116 |
|---|---|
| PubChem CID | 174087116 |
| Molecular Formula | C16H18BN5O5 |
| Molecular Weight | 371.16 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | — |
| SMILES | [B]c1cc([C@]2(C#N)O[C@H](CO)[C@@H](OC(=O)C(C)C)[C@H]2O)n2ncnc(N)c12 |
| InChI | InChI=1S/C16H18BN5O5/c1-7(2)15(25)26-12-9(4-23)27-16(5-18,13(12)24)10-3-8(17)11-14(19)20-6-21-22(10)11/h3,6-7,9,12-13,23-24H,4H2,1-2H3,(H2,19,20,21)/t9-,12-,13-,16+/m1/s1 |
| InChIKey | FKYPKTJUMOYJJW-PBWSWVRCSA-N |
| XLogP | -1.86 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.16 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|