C23H34BNO3 — CID 174097652
(1R)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]tricyclo[4.3.1.13,8]undecan-1-ol (PubChem CID 174097652) has the molecular formula C23H34BNO3 and a molecular weight of 383.34 g/mol. Its IUPAC name is (1R)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]tricyclo[4.3.1.13,8]undecan-1-ol.
| Compound Name | (1R)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]tricyclo[4.3.1.13,8]undecan-1-ol |
|---|---|
| PubChem CID | 174097652 |
| Molecular Formula | C23H34BNO3 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (1R)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]tricyclo[4.3.1.13,8]undecan-1-ol |
| SMILES | CC1(C)OB(c2cccc(NC3C4CCC5CC(C4)C[C@]3(O)C5)c2)OC1(C)C |
| InChI | InChI=1S/C23H34BNO3/c1-21(2)22(3,4)28-24(27-21)18-6-5-7-19(12-18)25-20-17-9-8-15-10-16(11-17)14-23(20,26)13-15/h5-7,12,15-17,20,25-26H,8-11,13-14H2,1-4H3/t15?,16?,17?,20?,23-/m1/s1 |
| InChIKey | NUCKRSUAHGVQHZ-ODSSVOLDSA-N |
| XLogP | 3.73 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|