C21H26BO4P — CID 174098831
[2-cyclopropyloxy-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]phosphane (PubChem CID 174098831) has the molecular formula C21H26BO4P and a molecular weight of 384.22 g/mol. Its IUPAC name is [2-cyclopropyloxy-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]phosphane.
| Compound Name | [2-cyclopropyloxy-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]phosphane |
|---|---|
| PubChem CID | 174098831 |
| Molecular Formula | C21H26BO4P |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [2-cyclopropyloxy-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]phosphane |
| SMILES | CC1(C)OB(c2ccc(Oc3cccc(OC4CC4)c3P)cc2)OC1(C)C |
| InChI | InChI=1S/C21H26BO4P/c1-20(2)21(3,4)26-22(25-20)14-8-10-15(11-9-14)23-17-6-5-7-18(19(17)27)24-16-12-13-16/h5-11,16H,12-13,27H2,1-4H3 |
| InChIKey | GDGSOHOPAIAUCQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|