C36H40B2Br2O4Si — CID 174100526
(3-bromophenyl)-[3-bromo-4-[[4,5,5-trimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-4-yl]methyl]phenyl]-diphenylsilane (PubChem CID 174100526) has the molecular formula C36H40B2Br2O4Si and a molecular weight of 746.23 g/mol. Its IUPAC name is (3-bromophenyl)-[3-bromo-4-[[4,5,5-trimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-4-yl]methyl]phenyl]-diphenylsilane.
| Compound Name | (3-bromophenyl)-[3-bromo-4-[[4,5,5-trimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-4-yl]methyl]phenyl]-diphenylsilane |
|---|---|
| PubChem CID | 174100526 |
| Molecular Formula | C36H40B2Br2O4Si |
| Molecular Weight | 746.23 g/mol |
| Exact Mass | 744.12 |
| IUPAC Name | (3-bromophenyl)-[3-bromo-4-[[4,5,5-trimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-4-yl]methyl]phenyl]-diphenylsilane |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(Cc3ccc([Si](c4ccccc4)(c4ccccc4)c4cccc(Br)c4)cc3Br)O2)OC1(C)C |
| InChI | InChI=1S/C36H40B2Br2O4Si/c1-33(2)34(3,4)42-37(41-33)38-43-35(5,6)36(7,44-38)25-26-21-22-31(24-32(26)40)45(28-16-10-8-11-17-28,29-18-12-9-13-19-29)30-20-14-15-27(39)23-30/h8-24H,25H2,1-7H3 |
| InChIKey | MDILKBMJHFNSNL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.23 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|