About CID 174110569
CID 174110569 (PubChem CID 174110569) has the molecular formula C5H5BINO2
and a molecular weight of 248.82 g/mol.
Molecular Properties
| Compound Name | CID 174110569 |
| PubChem CID | 174110569 |
| Molecular Formula | C5H5BINO2 |
| Molecular Weight | 248.82 g/mol |
| Exact Mass | 248.95 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CCC(=O)N(I)C1=O |
| InChI | InChI=1S/C5H5BINO2/c6-3-1-2-4(9)8(7)5(3)10/h3H,1-2H2/t3-/m0/s1 |
| InChIKey | FJCADLVMTAEIBD-VKHMYHEASA-N |
| XLogP | 0.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.82 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 174110569 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174110569?
The IUPAC name of CID 174110569 (CID 174110569) is not available.
What is the SMILES notation for CID 174110569?
The canonical SMILES for CID 174110569 is [B][C@H]1CCC(=O)N(I)C1=O.
What is the InChIKey of CID 174110569?
The InChIKey is FJCADLVMTAEIBD-VKHMYHEASA-N. The full InChI is InChI=1S/C5H5BINO2/c6-3-1-2-4(9)8(7)5(3)10/h3H,1-2H2/t3-/m0/s1.
What are the key properties of CID 174110569?
CID 174110569 has a molecular weight of 248.82 g/mol, XLogP of 0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174110569 is sourced from PubChem (CID 174110569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).