C4H5IN2O2 — CID 148810679
3-amino-1-iodopyrrolidine-2,5-dione (PubChem CID 148810679) has the molecular formula C4H5IN2O2 and a molecular weight of 240.00 g/mol. Its IUPAC name is 3-amino-1-iodopyrrolidine-2,5-dione.
| Compound Name | 3-amino-1-iodopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 148810679 |
| Molecular Formula | C4H5IN2O2 |
| Molecular Weight | 240.00 g/mol |
| Exact Mass | 239.94 |
| IUPAC Name | 3-amino-1-iodopyrrolidine-2,5-dione |
| SMILES | NC1CC(=O)N(I)C1=O |
| InChI | InChI=1S/C4H5IN2O2/c5-7-3(8)1-2(6)4(7)9/h2H,1,6H2 |
| InChIKey | OPVQOQLSRJNAFW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.00 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|