C4H4INO2S — CID 130374102
1-iodo-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 130374102) has the molecular formula C4H4INO2S and a molecular weight of 257.05 g/mol. Its IUPAC name is 1-iodo-3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-iodo-3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130374102 |
| Molecular Formula | C4H4INO2S |
| Molecular Weight | 257.05 g/mol |
| Exact Mass | 256.90 |
| IUPAC Name | 1-iodo-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(S)C(=O)N1I |
| InChI | InChI=1S/C4H4INO2S/c5-6-3(7)1-2(9)4(6)8/h2,9H,1H2 |
| InChIKey | TYRFYSWQHKEKCN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.05 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|