C4H6NO2PS — CID 142981400
1-phosphanyl-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 142981400) has the molecular formula C4H6NO2PS and a molecular weight of 163.14 g/mol. Its IUPAC name is 1-phosphanyl-3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-phosphanyl-3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 142981400 |
| Molecular Formula | C4H6NO2PS |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 162.99 |
| IUPAC Name | 1-phosphanyl-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(S)C(=O)N1P |
| InChI | InChI=1S/C4H6NO2PS/c6-3-1-2(9)4(7)5(3)8/h2,9H,1,8H2 |
| InChIKey | HKOSRBRAMMLODY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|