C22H33N3O5S — CID 174115625
methyl 1-[[6-[2-[(2-methylbutan-2-yloxycarbonylamino)methyl]prop-2-enoxy]-3-pyridinyl]sulfanyl]piperidine-4-carboxylate (PubChem CID 174115625) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is methyl 1-[[6-[2-[(2-methylbutan-2-yloxycarbonylamino)methyl]prop-2-enoxy]-3-pyridinyl]sulfanyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[6-[2-[(2-methylbutan-2-yloxycarbonylamino)methyl]prop-2-enoxy]-3-pyridinyl]sulfanyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 174115625 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | methyl 1-[[6-[2-[(2-methylbutan-2-yloxycarbonylamino)methyl]prop-2-enoxy]-3-pyridinyl]sulfanyl]piperidine-4-carboxylate |
| SMILES | C=C(CNC(=O)OC(C)(C)CC)COc1ccc(SN2CCC(C(=O)OC)CC2)cn1 |
| InChI | InChI=1S/C22H33N3O5S/c1-6-22(3,4)30-21(27)24-13-16(2)15-29-19-8-7-18(14-23-19)31-25-11-9-17(10-12-25)20(26)28-5/h7-8,14,17H,2,6,9-13,15H2,1,3-5H3,(H,24,27) |
| InChIKey | HUZGDIFRKCXORU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|