C18H19FN4O2S — CID 17414605
1-[(2-fluorophenyl)methoxy]-3-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylpropan-2-ol (PubChem CID 17414605) has the molecular formula C18H19FN4O2S and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methoxy]-3-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylpropan-2-ol.
| Compound Name | 1-[(2-fluorophenyl)methoxy]-3-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 17414605 |
| Molecular Formula | C18H19FN4O2S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-[(2-fluorophenyl)methoxy]-3-[1-(3-methylphenyl)tetrazol-5-yl]sulfanylpropan-2-ol |
| SMILES | Cc1cccc(-n2nnnc2SCC(O)COCc2ccccc2F)c1 |
| InChI | InChI=1S/C18H19FN4O2S/c1-13-5-4-7-15(9-13)23-18(20-21-22-23)26-12-16(24)11-25-10-14-6-2-3-8-17(14)19/h2-9,16,24H,10-12H2,1H3 |
| InChIKey | BZXUMFXSKIQJIY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |