C26H45BN2O8 — CID 174147020
[3-methyl-1-[4-[[2-[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetyl]amino]butanoylamino]butyl]boronic acid (PubChem CID 174147020) has the molecular formula C26H45BN2O8 and a molecular weight of 524.46 g/mol. Its IUPAC name is [3-methyl-1-[4-[[2-[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetyl]amino]butanoylamino]butyl]boronic acid.
| Compound Name | [3-methyl-1-[4-[[2-[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetyl]amino]butanoylamino]butyl]boronic acid |
|---|---|
| PubChem CID | 174147020 |
| Molecular Formula | C26H45BN2O8 |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | [3-methyl-1-[4-[[2-[(1R,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]acetyl]amino]butanoylamino]butyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)CCCNC(=O)C[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)B(O)O |
| InChI | InChI=1S/C26H45BN2O8/c1-15(2)13-21(27(32)33)29-22(30)7-6-12-28-23(31)14-20-17(4)19-9-8-16(3)18-10-11-25(5)35-24(34-20)26(18,19)37-36-25/h15-21,24,32-33H,6-14H2,1-5H3,(H,28,31)(H,29,30)/t16-,17-,18+,19+,20-,21?,24-,25-,26-/m1/s1 |
| InChIKey | ANHGYOSWFWIVLG-VPNBVQRDSA-N |
| XLogP | 2.07 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|