C55H45N3 — CID 174148063
3-[2-[4-(3,5-diphenylphenyl)phenyl]-6-ethenylphenyl]-4-methyl-N-[phenyl-(1-phenylethylideneamino)methyl]benzenecarboximidamide (PubChem CID 174148063) has the molecular formula C55H45N3 and a molecular weight of 747.99 g/mol. Its IUPAC name is 3-[2-[4-(3,5-diphenylphenyl)phenyl]-6-ethenylphenyl]-4-methyl-N-[phenyl-(1-phenylethylideneamino)methyl]benzenecarboximidamide.
| Compound Name | 3-[2-[4-(3,5-diphenylphenyl)phenyl]-6-ethenylphenyl]-4-methyl-N-[phenyl-(1-phenylethylideneamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 174148063 |
| Molecular Formula | C55H45N3 |
| Molecular Weight | 747.99 g/mol |
| Exact Mass | 747.36 |
| IUPAC Name | 3-[2-[4-(3,5-diphenylphenyl)phenyl]-6-ethenylphenyl]-4-methyl-N-[phenyl-(1-phenylethylideneamino)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\NC(N=C(C)c1ccccc1)c1ccccc1)c1ccc(C)c(-c2c(C=C)cccc2-c2ccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc2)c1 |
| InChI | InChI=1S/C55H45N3/c1-4-40-26-17-27-51(45-32-30-44(31-33-45)50-35-48(42-20-11-6-12-21-42)34-49(36-50)43-22-13-7-14-23-43)53(40)52-37-47(29-28-38(52)2)54(56)58-55(46-24-15-8-16-25-46)57-39(3)41-18-9-5-10-19-41/h4-37,55H,1H2,2-3H3,(H2,56,58) |
| InChIKey | RBJYTHMCXWXAEF-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.99 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|