C47H34N2O — CID 118229712
(2E)-2-[[1-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]ethylideneamino]-phenylmethylidene]-1-benzofuran-3-imine (PubChem CID 118229712) has the molecular formula C47H34N2O and a molecular weight of 642.80 g/mol. Its IUPAC name is (2E)-2-[[1-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]ethylideneamino]-phenylmethylidene]-1-benzofuran-3-imine.
| Compound Name | (2E)-2-[[1-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]ethylideneamino]-phenylmethylidene]-1-benzofuran-3-imine |
|---|---|
| PubChem CID | 118229712 |
| Molecular Formula | C47H34N2O |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | (2E)-2-[[1-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]ethylideneamino]-phenylmethylidene]-1-benzofuran-3-imine |
| SMILES | [H]/N=C1C(=C(\N=C(/C)c2cccc(-c3cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c3)c2)c2ccccc2)/Oc2ccccc2/1 |
| InChI | InChI=1S/C47H34N2O/c1-32(49-46(35-19-9-4-10-20-35)47-45(48)43-25-11-12-26-44(43)50-47)36-21-13-22-37(27-36)38-23-14-24-39(28-38)42-30-40(33-15-5-2-6-16-33)29-41(31-42)34-17-7-3-8-18-34/h2-31,48H,1H3/b47-46+,48-45+,49-32+ |
| InChIKey | RTTRWRMSRYBEQR-GPOOKWGMSA-N |
| XLogP | 11.99 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|