C19H20ClF2N3O5 — CID 174161054
[(2R,3R,4R,5R,6R)-4-[4-(4-chloro-2,3-difluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-prop-2-enyloxan-2-yl]methyl acetate (PubChem CID 174161054) has the molecular formula C19H20ClF2N3O5 and a molecular weight of 443.83 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-4-[4-(4-chloro-2,3-difluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-prop-2-enyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-4-[4-(4-chloro-2,3-difluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-prop-2-enyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 174161054 |
| Molecular Formula | C19H20ClF2N3O5 |
| Molecular Weight | 443.83 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-4-[4-(4-chloro-2,3-difluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-prop-2-enyloxan-2-yl]methyl acetate |
| SMILES | C=CC[C@H]1O[C@H](COC(C)=O)[C@H](O)[C@H](n2cc(-c3ccc(Cl)c(F)c3F)nn2)[C@H]1O |
| InChI | InChI=1S/C19H20ClF2N3O5/c1-3-4-13-18(27)17(19(28)14(30-13)8-29-9(2)26)25-7-12(23-24-25)10-5-6-11(20)16(22)15(10)21/h3,5-7,13-14,17-19,27-28H,1,4,8H2,2H3/t13-,14-,17-,18+,19+/m1/s1 |
| InChIKey | JJTUOXOIMSNKSM-ACJWMLNOSA-N |
| XLogP | 2.05 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.83 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|