C21H40N2O4 — CID 174169165
6,6-dimethyl-2-[6-(methylamino)hexanoylamino]-5-oxododecanoic acid (PubChem CID 174169165) has the molecular formula C21H40N2O4 and a molecular weight of 384.56 g/mol. Its IUPAC name is 6,6-dimethyl-2-[6-(methylamino)hexanoylamino]-5-oxododecanoic acid.
| Compound Name | 6,6-dimethyl-2-[6-(methylamino)hexanoylamino]-5-oxododecanoic acid |
|---|---|
| PubChem CID | 174169165 |
| Molecular Formula | C21H40N2O4 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 6,6-dimethyl-2-[6-(methylamino)hexanoylamino]-5-oxododecanoic acid |
| SMILES | CCCCCCC(C)(C)C(=O)CCC(NC(=O)CCCCCNC)C(=O)O |
| InChI | InChI=1S/C21H40N2O4/c1-5-6-7-10-15-21(2,3)18(24)14-13-17(20(26)27)23-19(25)12-9-8-11-16-22-4/h17,22H,5-16H2,1-4H3,(H,23,25)(H,26,27) |
| InChIKey | AKFFKYGANAIOFW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|