C29H34O4P2 — CID 174181743
[(8R)-5-benzoyloxy-3,6-dimethyl-8-methylphosphanyl-1-phosphanyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] benzoate (PubChem CID 174181743) has the molecular formula C29H34O4P2 and a molecular weight of 508.54 g/mol. Its IUPAC name is [(8R)-5-benzoyloxy-3,6-dimethyl-8-methylphosphanyl-1-phosphanyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] benzoate.
| Compound Name | [(8R)-5-benzoyloxy-3,6-dimethyl-8-methylphosphanyl-1-phosphanyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] benzoate |
|---|---|
| PubChem CID | 174181743 |
| Molecular Formula | C29H34O4P2 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | [(8R)-5-benzoyloxy-3,6-dimethyl-8-methylphosphanyl-1-phosphanyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] benzoate |
| SMILES | CP[C@]12CCC(P)(C1)C1C2C2(C)CC1(C)C(OC(=O)c1ccccc1)C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34O4P2/c1-26-16-27(2,21-20(26)28(34)14-15-29(21,17-28)35-3)23(33-25(31)19-12-8-5-9-13-19)22(26)32-24(30)18-10-6-4-7-11-18/h4-13,20-23,35H,14-17,34H2,1-3H3/t20?,21?,22?,23?,26?,27?,28?,29-/m1/s1 |
| InChIKey | FWEOOQBFSRHRRN-YQJSUTHNSA-N |
| XLogP | 5.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|