C29H35NO4P2 — CID 174181863
[5-benzoyloxy-1,8-dimethyl-3,6-bis(methylphosphanyl)-11-azatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl] benzoate (PubChem CID 174181863) has the molecular formula C29H35NO4P2 and a molecular weight of 523.55 g/mol. Its IUPAC name is [5-benzoyloxy-1,8-dimethyl-3,6-bis(methylphosphanyl)-11-azatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl] benzoate.
| Compound Name | [5-benzoyloxy-1,8-dimethyl-3,6-bis(methylphosphanyl)-11-azatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl] benzoate |
|---|---|
| PubChem CID | 174181863 |
| Molecular Formula | C29H35NO4P2 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | [5-benzoyloxy-1,8-dimethyl-3,6-bis(methylphosphanyl)-11-azatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl] benzoate |
| SMILES | CPC12CC(PC)(C(OC(=O)c3ccccc3)C1OC(=O)c1ccccc1)C1C2C2(C)CCC1(C)N2 |
| InChI | InChI=1S/C29H35NO4P2/c1-26-15-16-27(2,30-26)21-20(26)28(35-3)17-29(21,36-4)23(34-25(32)19-13-9-6-10-14-19)22(28)33-24(31)18-11-7-5-8-12-18/h5-14,20-23,30,35-36H,15-17H2,1-4H3 |
| InChIKey | ATMYJHPPAMHLPY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|