C15H19N3 — CID 174183126
N'-[(Z)-3-[(5Z)-5-[(Z)-but-2-enylidene]-6-methylidene-3-pyridinyl]prop-1-enyl]ethanimidamide (PubChem CID 174183126) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is N'-[(Z)-3-[(5Z)-5-[(Z)-but-2-enylidene]-6-methylidene-3-pyridinyl]prop-1-enyl]ethanimidamide.
| Compound Name | N'-[(Z)-3-[(5Z)-5-[(Z)-but-2-enylidene]-6-methylidene-3-pyridinyl]prop-1-enyl]ethanimidamide |
|---|---|
| PubChem CID | 174183126 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N'-[(Z)-3-[(5Z)-5-[(Z)-but-2-enylidene]-6-methylidene-3-pyridinyl]prop-1-enyl]ethanimidamide |
| SMILES | C=c1ncc(C/C=C\N=C(/C)N)c/c1=C/C=C\C |
| InChI | InChI=1S/C15H19N3/c1-4-5-8-15-10-14(11-18-12(15)2)7-6-9-17-13(3)16/h4-6,8-11H,2,7H2,1,3H3,(H2,16,17)/b5-4-,9-6-,15-8- |
| InChIKey | AIFDYDLRHZWOQI-YEWCDYJVSA-N |
| XLogP | 1.28 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|