C26H36O8 — CID 174183671
(2S,3R,4S,5R,6R)-2-[(3S,4R)-3,4-bis(phenylmethoxy)hexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 174183671) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[(3S,4R)-3,4-bis(phenylmethoxy)hexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[(3S,4R)-3,4-bis(phenylmethoxy)hexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 174183671 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[(3S,4R)-3,4-bis(phenylmethoxy)hexoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC[C@@H](OCc1ccccc1)[C@H](CCO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C26H36O8/c1-2-20(32-16-18-9-5-3-6-10-18)21(33-17-19-11-7-4-8-12-19)13-14-31-26-25(30)24(29)23(28)22(15-27)34-26/h3-12,20-30H,2,13-17H2,1H3/t20-,21+,22-,23+,24+,25-,26+/m1/s1 |
| InChIKey | UOJLXBLWMYGRRM-CCMVJMFSSA-N |
| XLogP | 1.77 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |