C21H22N2O3S — CID 174191717
3-[[3-cyano-4-(cyclohexylmethyl)-6-oxo-1H-pyridin-2-yl]sulfanyl]-2-methylbenzoic acid (PubChem CID 174191717) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-[[3-cyano-4-(cyclohexylmethyl)-6-oxo-1H-pyridin-2-yl]sulfanyl]-2-methylbenzoic acid.
| Compound Name | 3-[[3-cyano-4-(cyclohexylmethyl)-6-oxo-1H-pyridin-2-yl]sulfanyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 174191717 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-[[3-cyano-4-(cyclohexylmethyl)-6-oxo-1H-pyridin-2-yl]sulfanyl]-2-methylbenzoic acid |
| SMILES | Cc1c(Sc2[nH]c(=O)cc(CC3CCCCC3)c2C#N)cccc1C(=O)O |
| InChI | InChI=1S/C21H22N2O3S/c1-13-16(21(25)26)8-5-9-18(13)27-20-17(12-22)15(11-19(24)23-20)10-14-6-3-2-4-7-14/h5,8-9,11,14H,2-4,6-7,10H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | ZSTZCNJDEFBPSF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |