C12H27NO8P2 — CID 174192776
[3-methyl-2-(methylamino)butyl] (4-phosphonooxycyclohexyl) hydrogen phosphate (PubChem CID 174192776) has the molecular formula C12H27NO8P2 and a molecular weight of 375.30 g/mol. Its IUPAC name is [3-methyl-2-(methylamino)butyl] (4-phosphonooxycyclohexyl) hydrogen phosphate.
| Compound Name | [3-methyl-2-(methylamino)butyl] (4-phosphonooxycyclohexyl) hydrogen phosphate |
|---|---|
| PubChem CID | 174192776 |
| Molecular Formula | C12H27NO8P2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [3-methyl-2-(methylamino)butyl] (4-phosphonooxycyclohexyl) hydrogen phosphate |
| SMILES | CNC(COP(=O)(O)OC1CCC(OP(=O)(O)O)CC1)C(C)C |
| InChI | InChI=1S/C12H27NO8P2/c1-9(2)12(13-3)8-19-23(17,18)21-11-6-4-10(5-7-11)20-22(14,15)16/h9-13H,4-8H2,1-3H3,(H,17,18)(H2,14,15,16) |
| InChIKey | ZGFABYAVSXSAHM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|