C31H28N2O3 — CID 174202182
4-[2-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]phenyl]-1-methylpyridin-2-one (PubChem CID 174202182) has the molecular formula C31H28N2O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 4-[2-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]phenyl]-1-methylpyridin-2-one.
| Compound Name | 4-[2-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]phenyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 174202182 |
| Molecular Formula | C31H28N2O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 4-[2-[1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethylamino]phenyl]-1-methylpyridin-2-one |
| SMILES | Cc1cc(C(C)Nc2ccccc2-c2ccn(C)c(=O)c2)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C31H28N2O3/c1-19-16-25(31-26(17-19)29(35)20(2)30(36-31)22-10-6-5-7-11-22)21(3)32-27-13-9-8-12-24(27)23-14-15-33(4)28(34)18-23/h5-18,21,32H,1-4H3 |
| InChIKey | OBLZXJAZQJMOCX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|