C15H16F3NO2S — CID 174205899
8-(1-aminoethyl)-2-ethylsulfanyl-3-methyl-6-(trifluoromethyl)chromen-4-one (PubChem CID 174205899) has the molecular formula C15H16F3NO2S and a molecular weight of 331.36 g/mol. Its IUPAC name is 8-(1-aminoethyl)-2-ethylsulfanyl-3-methyl-6-(trifluoromethyl)chromen-4-one.
| Compound Name | 8-(1-aminoethyl)-2-ethylsulfanyl-3-methyl-6-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 174205899 |
| Molecular Formula | C15H16F3NO2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 8-(1-aminoethyl)-2-ethylsulfanyl-3-methyl-6-(trifluoromethyl)chromen-4-one |
| SMILES | CCSc1oc2c(C(C)N)cc(C(F)(F)F)cc2c(=O)c1C |
| InChI | InChI=1S/C15H16F3NO2S/c1-4-22-14-7(2)12(20)11-6-9(15(16,17)18)5-10(8(3)19)13(11)21-14/h5-6,8H,4,19H2,1-3H3 |
| InChIKey | ZASPBKSLVKZWEU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |