C12H14N2O2 — CID 174208584
(2,3,3-trimethylindol-5-yl)carbamic acid (PubChem CID 174208584) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (2,3,3-trimethylindol-5-yl)carbamic acid.
| Compound Name | (2,3,3-trimethylindol-5-yl)carbamic acid |
|---|---|
| PubChem CID | 174208584 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (2,3,3-trimethylindol-5-yl)carbamic acid |
| SMILES | CC1=Nc2ccc(NC(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C12H14N2O2/c1-7-12(2,3)9-6-8(14-11(15)16)4-5-10(9)13-7/h4-6,14H,1-3H3,(H,15,16) |
| InChIKey | AONJJFRDIHVGFL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |