C28H45BrN4O5 — CID 174208771
(2R)-N'-(3-bromo-2,4,6-trimethylphenyl)-2-(butanoylamino)-N-[2-[2-(hexanoylamino)ethoxy]ethyl]pentanediamide (PubChem CID 174208771) has the molecular formula C28H45BrN4O5 and a molecular weight of 597.60 g/mol. Its IUPAC name is (2R)-N'-(3-bromo-2,4,6-trimethylphenyl)-2-(butanoylamino)-N-[2-[2-(hexanoylamino)ethoxy]ethyl]pentanediamide.
| Compound Name | (2R)-N'-(3-bromo-2,4,6-trimethylphenyl)-2-(butanoylamino)-N-[2-[2-(hexanoylamino)ethoxy]ethyl]pentanediamide |
|---|---|
| PubChem CID | 174208771 |
| Molecular Formula | C28H45BrN4O5 |
| Molecular Weight | 597.60 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | (2R)-N'-(3-bromo-2,4,6-trimethylphenyl)-2-(butanoylamino)-N-[2-[2-(hexanoylamino)ethoxy]ethyl]pentanediamide |
| SMILES | CCCCCC(=O)NCCOCCNC(=O)[C@@H](CCC(=O)Nc1c(C)cc(C)c(Br)c1C)NC(=O)CCC |
| InChI | InChI=1S/C28H45BrN4O5/c1-6-8-9-11-23(34)30-14-16-38-17-15-31-28(37)22(32-24(35)10-7-2)12-13-25(36)33-27-20(4)18-19(3)26(29)21(27)5/h18,22H,6-17H2,1-5H3,(H,30,34)(H,31,37)(H,32,35)(H,33,36)/t22-/m1/s1 |
| InChIKey | IHDCFRNYHGMRLA-JOCHJYFZSA-N |
| XLogP | 4.21 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|