C17H19N3O2 — CID 17421167
N'-[2-(1-methylpyrrol-2-yl)acetyl]-2,3-dihydro-1H-indene-5-carbohydrazide (PubChem CID 17421167) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N'-[2-(1-methylpyrrol-2-yl)acetyl]-2,3-dihydro-1H-indene-5-carbohydrazide.
| Compound Name | N'-[2-(1-methylpyrrol-2-yl)acetyl]-2,3-dihydro-1H-indene-5-carbohydrazide |
|---|---|
| PubChem CID | 17421167 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N'-[2-(1-methylpyrrol-2-yl)acetyl]-2,3-dihydro-1H-indene-5-carbohydrazide |
| SMILES | Cn1cccc1CC(=O)NNC(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H19N3O2/c1-20-9-3-6-15(20)11-16(21)18-19-17(22)14-8-7-12-4-2-5-13(12)10-14/h3,6-10H,2,4-5,11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | HPXQMIOAFCMWNT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|