C17H25N3O5S — CID 174216123
(2S,6R)-2-[1-(methoxymethyl)pyrazol-4-yl]-6-methylmorpholine;4-methylbenzenesulfonic acid (PubChem CID 174216123) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is (2S,6R)-2-[1-(methoxymethyl)pyrazol-4-yl]-6-methylmorpholine;4-methylbenzenesulfonic acid.
| Compound Name | (2S,6R)-2-[1-(methoxymethyl)pyrazol-4-yl]-6-methylmorpholine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174216123 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (2S,6R)-2-[1-(methoxymethyl)pyrazol-4-yl]-6-methylmorpholine;4-methylbenzenesulfonic acid |
| SMILES | COCn1cc([C@H]2CNC[C@@H](C)O2)cn1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H17N3O2.C7H8O3S/c1-8-3-11-5-10(15-8)9-4-12-13(6-9)7-14-2;1-6-2-4-7(5-3-6)11(8,9)10/h4,6,8,10-11H,3,5,7H2,1-2H3;2-5H,1H3,(H,8,9,10)/t8-,10-;/m1./s1 |
| InChIKey | ZEGLFWFNKSHZMJ-GHXDPTCOSA-N |
| XLogP | 1.78 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|