About 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine
4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine (PubChem CID 87514386) has the molecular formula C15H25NO4S
and a molecular weight of 315.43 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine |
| PubChem CID | 87514386 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine |
| SMILES | C[C@@H]1CC[C@@H](CCCN)O1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C8H17NO.C7H8O3S/c1-7-4-5-8(10-7)3-2-6-9;1-6-2-4-7(5-3-6)11(8,9)10/h7-8H,2-6,9H2,1H3;2-5H,1H3,(H,8,9,10)/t7-,8-;/m1./s1 |
| InChIKey | FOJJCOHJPCZEIS-SCLLHFNJSA-N |
| XLogP | 2.53 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine?
The IUPAC name of 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine (CID 87514386) is 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine.
What is the SMILES notation for 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine?
The canonical SMILES for 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine is C[C@@H]1CC[C@@H](CCCN)O1.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine?
The InChIKey is FOJJCOHJPCZEIS-SCLLHFNJSA-N. The full InChI is InChI=1S/C8H17NO.C7H8O3S/c1-7-4-5-8(10-7)3-2-6-9;1-6-2-4-7(5-3-6)11(8,9)10/h7-8H,2-6,9H2,1H3;2-5H,1H3,(H,8,9,10)/t7-,8-;/m1./s1.
What are the key properties of 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine?
4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine has a molecular weight of 315.43 g/mol, XLogP of 2.53, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonic acid;3-[(2R,5R)-5-methyloxolan-2-yl]propan-1-amine is sourced from PubChem (CID 87514386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).