C15H20ClNO3 — CID 174218233
4a-(3-chlorophenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;formic acid (PubChem CID 174218233) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 4a-(3-chlorophenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;formic acid.
| Compound Name | 4a-(3-chlorophenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;formic acid |
|---|---|
| PubChem CID | 174218233 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4a-(3-chlorophenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine;formic acid |
| SMILES | Clc1cccc(C23CCCCC2OCCN3)c1.O=CO |
| InChI | InChI=1S/C14H18ClNO.CH2O2/c15-12-5-3-4-11(10-12)14-7-2-1-6-13(14)17-9-8-16-14;2-1-3/h3-5,10,13,16H,1-2,6-9H2;1H,(H,2,3) |
| InChIKey | DJGQPNLGDMYALE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|