C15H21F2NO3S — CID 174222523
N-[1-[3-(1,1-difluoro-2-methoxyethyl)phenyl]ethylidene]-2-methylpropane-2-sulfonamide (PubChem CID 174222523) has the molecular formula C15H21F2NO3S and a molecular weight of 333.40 g/mol. Its IUPAC name is N-[1-[3-(1,1-difluoro-2-methoxyethyl)phenyl]ethylidene]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[1-[3-(1,1-difluoro-2-methoxyethyl)phenyl]ethylidene]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 174222523 |
| Molecular Formula | C15H21F2NO3S |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[1-[3-(1,1-difluoro-2-methoxyethyl)phenyl]ethylidene]-2-methylpropane-2-sulfonamide |
| SMILES | COCC(F)(F)c1cccc(C(C)=NS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H21F2NO3S/c1-11(18-22(19,20)14(2,3)4)12-7-6-8-13(9-12)15(16,17)10-21-5/h6-9H,10H2,1-5H3 |
| InChIKey | XJMVYGCMSNOTLE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|