C14H19F2NO2S — CID 153283559
(NE,R)-N-[1-[3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 153283559) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is (NE,R)-N-[1-[3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[1-[3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 153283559 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (NE,R)-N-[1-[3-(1,1-difluoro-2-hydroxyethyl)phenyl]ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C/C(=N\[S@](=O)C(C)(C)C)c1cccc(C(F)(F)CO)c1 |
| InChI | InChI=1S/C14H19F2NO2S/c1-10(17-20(19)13(2,3)4)11-6-5-7-12(8-11)14(15,16)9-18/h5-8,18H,9H2,1-4H3/b17-10+/t20-/m1/s1 |
| InChIKey | LTIMJQCQURMMKP-OTJDAXFFSA-N |
| XLogP | 3.04 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|