C31H43N5O4S — CID 174224027
2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoylamino]-N-[2-[(2,4,6-trimethylphenyl)sulfonylamino]propyl]spiro[3.3]heptane-6-carboxamide (PubChem CID 174224027) has the molecular formula C31H43N5O4S and a molecular weight of 581.78 g/mol. Its IUPAC name is 2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoylamino]-N-[2-[(2,4,6-trimethylphenyl)sulfonylamino]propyl]spiro[3.3]heptane-6-carboxamide.
| Compound Name | 2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoylamino]-N-[2-[(2,4,6-trimethylphenyl)sulfonylamino]propyl]spiro[3.3]heptane-6-carboxamide |
|---|---|
| PubChem CID | 174224027 |
| Molecular Formula | C31H43N5O4S |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | 2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoylamino]-N-[2-[(2,4,6-trimethylphenyl)sulfonylamino]propyl]spiro[3.3]heptane-6-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(C)CNC(=O)C2CC3(CC(NC(=O)CCc4ccc5c(n4)NCCC5)C3)C2)c(C)c1 |
| InChI | InChI=1S/C31H43N5O4S/c1-19-12-20(2)28(21(3)13-19)41(39,40)36-22(4)18-33-30(38)24-14-31(15-24)16-26(17-31)34-27(37)10-9-25-8-7-23-6-5-11-32-29(23)35-25/h7-8,12-13,22,24,26,36H,5-6,9-11,14-18H2,1-4H3,(H,32,35)(H,33,38)(H,34,37) |
| InChIKey | BXDNWGWXTXVDST-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |