C22H20N5O5S- — CID 174239632
[[3-[(E)-[[6-(4-ethoxyphenyl)pyrazine-2-carbonyl]hydrazinylidene]methyl]benzoyl]amino]methanesulfinate (PubChem CID 174239632) has the molecular formula C22H20N5O5S- and a molecular weight of 466.50 g/mol. Its IUPAC name is [[3-[(E)-[[6-(4-ethoxyphenyl)pyrazine-2-carbonyl]hydrazinylidene]methyl]benzoyl]amino]methanesulfinate.
| Compound Name | [[3-[(E)-[[6-(4-ethoxyphenyl)pyrazine-2-carbonyl]hydrazinylidene]methyl]benzoyl]amino]methanesulfinate |
|---|---|
| PubChem CID | 174239632 |
| Molecular Formula | C22H20N5O5S- |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | [[3-[(E)-[[6-(4-ethoxyphenyl)pyrazine-2-carbonyl]hydrazinylidene]methyl]benzoyl]amino]methanesulfinate |
| SMILES | CCOc1ccc(-c2cncc(C(=O)N/N=C/c3cccc(C(=O)NCS(=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C22H21N5O5S/c1-2-32-18-8-6-16(7-9-18)19-12-23-13-20(26-19)22(29)27-25-11-15-4-3-5-17(10-15)21(28)24-14-33(30)31/h3-13H,2,14H2,1H3,(H,24,28)(H,27,29)(H,30,31)/p-1/b25-11+ |
| InChIKey | WDJJWGZJAMNKBN-OPEKNORGSA-M |
| XLogP | 1.87 |
| TPSA | 145.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|